C19H25FN2S — CID 153428373
2-(4-fluorophenyl)-5-(4-pentylcyclohexyl)-1,3,4-thiadiazole (PubChem CID 153428373) has the molecular formula C19H25FN2S and a molecular weight of 332.49 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-(4-pentylcyclohexyl)-1,3,4-thiadiazole.
| Compound Name | 2-(4-fluorophenyl)-5-(4-pentylcyclohexyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 153428373 |
| Molecular Formula | C19H25FN2S |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-(4-fluorophenyl)-5-(4-pentylcyclohexyl)-1,3,4-thiadiazole |
| SMILES | CCCCCC1CCC(c2nnc(-c3ccc(F)cc3)s2)CC1 |
| InChI | InChI=1S/C19H25FN2S/c1-2-3-4-5-14-6-8-15(9-7-14)18-21-22-19(23-18)16-10-12-17(20)13-11-16/h10-15H,2-9H2,1H3 |
| InChIKey | DASCLOCANVQTBC-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|