C17H16N4O3 — CID 40525614
ethyl (2R)-2-benzamido-2-(benzotriazol-1-yl)acetate (PubChem CID 40525614) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is ethyl (2R)-2-benzamido-2-(benzotriazol-1-yl)acetate.
| Compound Name | ethyl (2R)-2-benzamido-2-(benzotriazol-1-yl)acetate |
|---|---|
| PubChem CID | 40525614 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | ethyl (2R)-2-benzamido-2-(benzotriazol-1-yl)acetate |
| SMILES | CCOC(=O)[C@H](NC(=O)c1ccccc1)n1nnc2ccccc21 |
| InChI | InChI=1S/C17H16N4O3/c1-2-24-17(23)15(18-16(22)12-8-4-3-5-9-12)21-14-11-7-6-10-13(14)19-20-21/h3-11,15H,2H2,1H3,(H,18,22)/t15-/m1/s1 |
| InChIKey | BXWOHGIFYNSQLJ-OAHLLOKOSA-N |
| XLogP | 1.92 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |