C17H13Cl2F3N4O — CID 18770736
N-[1-(benzotriazol-1-yl)-2,2-dichloropropyl]-4-(trifluoromethyl)benzamide (PubChem CID 18770736) has the molecular formula C17H13Cl2F3N4O and a molecular weight of 417.22 g/mol. Its IUPAC name is N-[1-(benzotriazol-1-yl)-2,2-dichloropropyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[1-(benzotriazol-1-yl)-2,2-dichloropropyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 18770736 |
| Molecular Formula | C17H13Cl2F3N4O |
| Molecular Weight | 417.22 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | N-[1-(benzotriazol-1-yl)-2,2-dichloropropyl]-4-(trifluoromethyl)benzamide |
| SMILES | CC(Cl)(Cl)C(NC(=O)c1ccc(C(F)(F)F)cc1)n1nnc2ccccc21 |
| InChI | InChI=1S/C17H13Cl2F3N4O/c1-16(18,19)15(26-13-5-3-2-4-12(13)24-25-26)23-14(27)10-6-8-11(9-7-10)17(20,21)22/h2-9,15H,1H3,(H,23,27) |
| InChIKey | RPHLYNNJTOQPMM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.22 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|