C9H9F8NO4 — CID 13173285
methyl 2-acetamido-3,3,4,4,5,5,6,6-octafluoro-2-hydroxyhexanoate (PubChem CID 13173285) has the molecular formula C9H9F8NO4 and a molecular weight of 347.16 g/mol. Its IUPAC name is methyl 2-acetamido-3,3,4,4,5,5,6,6-octafluoro-2-hydroxyhexanoate.
| Compound Name | methyl 2-acetamido-3,3,4,4,5,5,6,6-octafluoro-2-hydroxyhexanoate |
|---|---|
| PubChem CID | 13173285 |
| Molecular Formula | C9H9F8NO4 |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | methyl 2-acetamido-3,3,4,4,5,5,6,6-octafluoro-2-hydroxyhexanoate |
| SMILES | COC(=O)C(O)(NC(C)=O)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H9F8NO4/c1-3(19)18-7(21,5(20)22-2)9(16,17)8(14,15)6(12,13)4(10)11/h4,21H,1-2H3,(H,18,19) |
| InChIKey | GHLJMODRZSCBSF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|