C6H8F8N4O2 — CID 98463171
(2R)-3,3,4,4,5,5,6,6-octafluoro-2-hydrazinyl-2-hydroxyhexanehydrazide (PubChem CID 98463171) has the molecular formula C6H8F8N4O2 and a molecular weight of 320.14 g/mol. Its IUPAC name is (2R)-3,3,4,4,5,5,6,6-octafluoro-2-hydrazinyl-2-hydroxyhexanehydrazide.
| Compound Name | (2R)-3,3,4,4,5,5,6,6-octafluoro-2-hydrazinyl-2-hydroxyhexanehydrazide |
|---|---|
| PubChem CID | 98463171 |
| Molecular Formula | C6H8F8N4O2 |
| Molecular Weight | 320.14 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | (2R)-3,3,4,4,5,5,6,6-octafluoro-2-hydrazinyl-2-hydroxyhexanehydrazide |
| SMILES | NNC(=O)[C@](O)(NN)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C6H8F8N4O2/c7-1(8)3(9,10)5(11,12)6(13,14)4(20,18-16)2(19)17-15/h1,18,20H,15-16H2,(H,17,19)/t4-/m1/s1 |
| InChIKey | CJKRTRPMCVYKIS-SCSAIBSYSA-N |
| XLogP | -0.70 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.14 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|