C8H13O4- — CID 71347352
(2S)-2-methoxycarbonyl-3,3-dimethylbutanoate (PubChem CID 71347352) has the molecular formula C8H13O4- and a molecular weight of 173.19 g/mol. Its IUPAC name is (2S)-2-methoxycarbonyl-3,3-dimethylbutanoate.
| Compound Name | (2S)-2-methoxycarbonyl-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 71347352 |
| Molecular Formula | C8H13O4- |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | (2S)-2-methoxycarbonyl-3,3-dimethylbutanoate |
| SMILES | COC(=O)[C@H](C(=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C8H14O4/c1-8(2,3)5(6(9)10)7(11)12-4/h5H,1-4H3,(H,9,10)/p-1/t5-/m0/s1 |
| InChIKey | XBWHOMGWRUJNPO-YFKPBYRVSA-M |
| XLogP | -0.43 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|