C25H35NO4 — CID 10309904
tert-butyl N-[5-(4-tert-butylphenyl)-1-(furan-2-yl)-2-methyl-3-oxopentyl]carbamate (PubChem CID 10309904) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is tert-butyl N-[5-(4-tert-butylphenyl)-1-(furan-2-yl)-2-methyl-3-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[5-(4-tert-butylphenyl)-1-(furan-2-yl)-2-methyl-3-oxopentyl]carbamate |
|---|---|
| PubChem CID | 10309904 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | tert-butyl N-[5-(4-tert-butylphenyl)-1-(furan-2-yl)-2-methyl-3-oxopentyl]carbamate |
| SMILES | CC(C(=O)CCc1ccc(C(C)(C)C)cc1)C(NC(=O)OC(C)(C)C)c1ccco1 |
| InChI | InChI=1S/C25H35NO4/c1-17(20(27)15-12-18-10-13-19(14-11-18)24(2,3)4)22(21-9-8-16-29-21)26-23(28)30-25(5,6)7/h8-11,13-14,16-17,22H,12,15H2,1-7H3,(H,26,28) |
| InChIKey | HHIMUUOOKVDIFT-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |