C27H37NO3 — CID 10216543
benzyl N-[7-(4-tert-butylphenyl)-2,4-dimethyl-5-oxoheptan-3-yl]carbamate (PubChem CID 10216543) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is benzyl N-[7-(4-tert-butylphenyl)-2,4-dimethyl-5-oxoheptan-3-yl]carbamate.
| Compound Name | benzyl N-[7-(4-tert-butylphenyl)-2,4-dimethyl-5-oxoheptan-3-yl]carbamate |
|---|---|
| PubChem CID | 10216543 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | benzyl N-[7-(4-tert-butylphenyl)-2,4-dimethyl-5-oxoheptan-3-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(C)C(=O)CCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H37NO3/c1-19(2)25(28-26(30)31-18-22-10-8-7-9-11-22)20(3)24(29)17-14-21-12-15-23(16-13-21)27(4,5)6/h7-13,15-16,19-20,25H,14,17-18H2,1-6H3,(H,28,30) |
| InChIKey | GSLGCFLVVKHDAX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |