C14H14O4S2 — CID 10710099
[(1R,2R)-2-acetyloxy-1,2-dithiophen-2-ylethyl] acetate (PubChem CID 10710099) has the molecular formula C14H14O4S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is [(1R,2R)-2-acetyloxy-1,2-dithiophen-2-ylethyl] acetate.
| Compound Name | [(1R,2R)-2-acetyloxy-1,2-dithiophen-2-ylethyl] acetate |
|---|---|
| PubChem CID | 10710099 |
| Molecular Formula | C14H14O4S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | [(1R,2R)-2-acetyloxy-1,2-dithiophen-2-ylethyl] acetate |
| SMILES | CC(=O)O[C@@H](c1cccs1)[C@@H](OC(C)=O)c1cccs1 |
| InChI | InChI=1S/C14H14O4S2/c1-9(15)17-13(11-5-3-7-19-11)14(18-10(2)16)12-6-4-8-20-12/h3-8,13-14H,1-2H3/t13-,14-/m0/s1 |
| InChIKey | KLTGOGUFZQWPQJ-KBPBESRZSA-N |
| XLogP | 3.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |