C15H21BO4S — CID 164672537
[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-thiophen-2-ylprop-2-enyl] acetate (PubChem CID 164672537) has the molecular formula C15H21BO4S and a molecular weight of 308.21 g/mol. Its IUPAC name is [(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-thiophen-2-ylprop-2-enyl] acetate.
| Compound Name | [(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-thiophen-2-ylprop-2-enyl] acetate |
|---|---|
| PubChem CID | 164672537 |
| Molecular Formula | C15H21BO4S |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | [(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-thiophen-2-ylprop-2-enyl] acetate |
| SMILES | CC(=O)OC(/C=C/B1OC(C)(C)C(C)(C)O1)c1cccs1 |
| InChI | InChI=1S/C15H21BO4S/c1-11(17)18-12(13-7-6-10-21-13)8-9-16-19-14(2,3)15(4,5)20-16/h6-10,12H,1-5H3/b9-8+ |
| InChIKey | IXYCWJBGSCHFQS-CMDGGOBGSA-N |
| XLogP | 3.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|