C11H14O2S — CID 135077736
4-thiophen-2-ylheptane-2,6-dione (PubChem CID 135077736) has the molecular formula C11H14O2S and a molecular weight of 210.30 g/mol. Its IUPAC name is 4-thiophen-2-ylheptane-2,6-dione.
| Compound Name | 4-thiophen-2-ylheptane-2,6-dione |
|---|---|
| PubChem CID | 135077736 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 4-thiophen-2-ylheptane-2,6-dione |
| SMILES | CC(=O)CC(CC(C)=O)c1cccs1 |
| InChI | InChI=1S/C11H14O2S/c1-8(12)6-10(7-9(2)13)11-4-3-5-14-11/h3-5,10H,6-7H2,1-2H3 |
| InChIKey | HXVQCUMVFLTYPV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |