C12H18ClNOS — CID 67780498
4-pyrrolidin-1-yl-4-thiophen-2-ylbutan-2-one;hydrochloride (PubChem CID 67780498) has the molecular formula C12H18ClNOS and a molecular weight of 259.80 g/mol. Its IUPAC name is 4-pyrrolidin-1-yl-4-thiophen-2-ylbutan-2-one;hydrochloride.
| Compound Name | 4-pyrrolidin-1-yl-4-thiophen-2-ylbutan-2-one;hydrochloride |
|---|---|
| PubChem CID | 67780498 |
| Molecular Formula | C12H18ClNOS |
| Molecular Weight | 259.80 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 4-pyrrolidin-1-yl-4-thiophen-2-ylbutan-2-one;hydrochloride |
| SMILES | CC(=O)CC(c1cccs1)N1CCCC1.Cl |
| InChI | InChI=1S/C12H17NOS.ClH/c1-10(14)9-11(12-5-4-8-15-12)13-6-2-3-7-13;/h4-5,8,11H,2-3,6-7,9H2,1H3;1H |
| InChIKey | NDWYXEYPSQSAJG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.80 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |