About 3-thiophen-2-yloctanoic acid
3-thiophen-2-yloctanoic acid (PubChem CID 57187162) has the molecular formula C12H18O2S
and a molecular weight of 226.34 g/mol. Its IUPAC name is 3-thiophen-2-yloctanoic acid.
Molecular Properties
| Compound Name | 3-thiophen-2-yloctanoic acid |
| PubChem CID | 57187162 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 3-thiophen-2-yloctanoic acid |
| SMILES | CCCCCC(CC(=O)O)c1cccs1 |
| InChI | InChI=1S/C12H18O2S/c1-2-3-4-6-10(9-12(13)14)11-7-5-8-15-11/h5,7-8,10H,2-4,6,9H2,1H3,(H,13,14) |
| InChIKey | PWONLJUIGBJPJU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-thiophen-2-yloctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-2-yloctanoic acid?
The IUPAC name of 3-thiophen-2-yloctanoic acid (CID 57187162) is 3-thiophen-2-yloctanoic acid.
What is the SMILES notation for 3-thiophen-2-yloctanoic acid?
The canonical SMILES for 3-thiophen-2-yloctanoic acid is CCCCCC(CC(=O)O)c1cccs1.
What is the InChIKey of 3-thiophen-2-yloctanoic acid?
The InChIKey is PWONLJUIGBJPJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2S/c1-2-3-4-6-10(9-12(13)14)11-7-5-8-15-11/h5,7-8,10H,2-4,6,9H2,1H3,(H,13,14).
What are the key properties of 3-thiophen-2-yloctanoic acid?
3-thiophen-2-yloctanoic acid has a molecular weight of 226.34 g/mol, XLogP of 3.89, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-2-yloctanoic acid is sourced from PubChem (CID 57187162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).