C11H15NO2S — CID 164672058
N-[(1R,2R)-1-methoxy-1-thiophen-2-ylbut-3-en-2-yl]acetamide (PubChem CID 164672058) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is N-[(1R,2R)-1-methoxy-1-thiophen-2-ylbut-3-en-2-yl]acetamide.
| Compound Name | N-[(1R,2R)-1-methoxy-1-thiophen-2-ylbut-3-en-2-yl]acetamide |
|---|---|
| PubChem CID | 164672058 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | N-[(1R,2R)-1-methoxy-1-thiophen-2-ylbut-3-en-2-yl]acetamide |
| SMILES | C=C[C@@H](NC(C)=O)[C@@H](OC)c1cccs1 |
| InChI | InChI=1S/C11H15NO2S/c1-4-9(12-8(2)13)11(14-3)10-6-5-7-15-10/h4-7,9,11H,1H2,2-3H3,(H,12,13)/t9-,11-/m1/s1 |
| InChIKey | UTPGAGOIFBKEAV-MWLCHTKSSA-N |
| XLogP | 2.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|