C14H18N2OS2 — CID 57223769
N-(3-amino-1,2-dithiophen-2-ylbutyl)acetamide (PubChem CID 57223769) has the molecular formula C14H18N2OS2 and a molecular weight of 294.45 g/mol. Its IUPAC name is N-(3-amino-1,2-dithiophen-2-ylbutyl)acetamide.
| Compound Name | N-(3-amino-1,2-dithiophen-2-ylbutyl)acetamide |
|---|---|
| PubChem CID | 57223769 |
| Molecular Formula | C14H18N2OS2 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N-(3-amino-1,2-dithiophen-2-ylbutyl)acetamide |
| SMILES | CC(=O)NC(c1cccs1)C(c1cccs1)C(C)N |
| InChI | InChI=1S/C14H18N2OS2/c1-9(15)13(11-5-3-7-18-11)14(16-10(2)17)12-6-4-8-19-12/h3-9,13-14H,15H2,1-2H3,(H,16,17) |
| InChIKey | JVGLAWVSQLPXIO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |