C14H19ClN2OS2 — CID 120501338
3-amino-N-(dithiophen-2-ylmethyl)-2-methylbutanamide;hydrochloride (PubChem CID 120501338) has the molecular formula C14H19ClN2OS2 and a molecular weight of 330.91 g/mol. Its IUPAC name is 3-amino-N-(dithiophen-2-ylmethyl)-2-methylbutanamide;hydrochloride.
| Compound Name | 3-amino-N-(dithiophen-2-ylmethyl)-2-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 120501338 |
| Molecular Formula | C14H19ClN2OS2 |
| Molecular Weight | 330.91 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 3-amino-N-(dithiophen-2-ylmethyl)-2-methylbutanamide;hydrochloride |
| SMILES | CC(N)C(C)C(=O)NC(c1cccs1)c1cccs1.Cl |
| InChI | InChI=1S/C14H18N2OS2.ClH/c1-9(10(2)15)14(17)16-13(11-5-3-7-18-11)12-6-4-8-19-12;/h3-10,13H,15H2,1-2H3,(H,16,17);1H |
| InChIKey | SECHGDKMMGJFNJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.91 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |