C13H23ClN2OS — CID 120501636
3-amino-2-methyl-N-(2-methyl-3-thiophen-2-ylpropyl)butanamide;hydrochloride (PubChem CID 120501636) has the molecular formula C13H23ClN2OS and a molecular weight of 290.86 g/mol. Its IUPAC name is 3-amino-2-methyl-N-(2-methyl-3-thiophen-2-ylpropyl)butanamide;hydrochloride.
| Compound Name | 3-amino-2-methyl-N-(2-methyl-3-thiophen-2-ylpropyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 120501636 |
| Molecular Formula | C13H23ClN2OS |
| Molecular Weight | 290.86 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 3-amino-2-methyl-N-(2-methyl-3-thiophen-2-ylpropyl)butanamide;hydrochloride |
| SMILES | CC(CNC(=O)C(C)C(C)N)Cc1cccs1.Cl |
| InChI | InChI=1S/C13H22N2OS.ClH/c1-9(7-12-5-4-6-17-12)8-15-13(16)10(2)11(3)14;/h4-6,9-11H,7-8,14H2,1-3H3,(H,15,16);1H |
| InChIKey | OWNZYSNNWJMLRT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.86 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |