C15H26N2O2S — CID 111507839
1-(2-hydroxy-3-methylpentyl)-3-(2-methyl-3-thiophen-2-ylpropyl)urea (PubChem CID 111507839) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 1-(2-hydroxy-3-methylpentyl)-3-(2-methyl-3-thiophen-2-ylpropyl)urea.
| Compound Name | 1-(2-hydroxy-3-methylpentyl)-3-(2-methyl-3-thiophen-2-ylpropyl)urea |
|---|---|
| PubChem CID | 111507839 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-(2-hydroxy-3-methylpentyl)-3-(2-methyl-3-thiophen-2-ylpropyl)urea |
| SMILES | CCC(C)C(O)CNC(=O)NCC(C)Cc1cccs1 |
| InChI | InChI=1S/C15H26N2O2S/c1-4-12(3)14(18)10-17-15(19)16-9-11(2)8-13-6-5-7-20-13/h5-7,11-12,14,18H,4,8-10H2,1-3H3,(H2,16,17,19) |
| InChIKey | GTHPYKJMFHNHAB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |