C13H18N2O4S — CID 60712518
methyl 2-[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]propanoate (PubChem CID 60712518) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is methyl 2-[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]propanoate.
| Compound Name | methyl 2-[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]propanoate |
|---|---|
| PubChem CID | 60712518 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | methyl 2-[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)CC(NC(C)=O)c1cccs1 |
| InChI | InChI=1S/C13H18N2O4S/c1-8(13(18)19-3)14-12(17)7-10(15-9(2)16)11-5-4-6-20-11/h4-6,8,10H,7H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | AWSMGPUJFZULIF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |