C10H11N3O2S — CID 79193756
3-acetamido-N-cyano-3-thiophen-2-ylpropanamide (PubChem CID 79193756) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 3-acetamido-N-cyano-3-thiophen-2-ylpropanamide.
| Compound Name | 3-acetamido-N-cyano-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 79193756 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 3-acetamido-N-cyano-3-thiophen-2-ylpropanamide |
| SMILES | CC(=O)NC(CC(=O)NC#N)c1cccs1 |
| InChI | InChI=1S/C10H11N3O2S/c1-7(14)13-8(5-10(15)12-6-11)9-3-2-4-16-9/h2-4,8H,5H2,1H3,(H,12,15)(H,13,14) |
| InChIKey | BEKYMTNUBOOAMB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|