C21H27N3S3 — CID 68714918
1,3,5-tris(1-thiophen-2-ylethyl)-1,3,5-triazinane (PubChem CID 68714918) has the molecular formula C21H27N3S3 and a molecular weight of 417.67 g/mol. Its IUPAC name is 1,3,5-tris(1-thiophen-2-ylethyl)-1,3,5-triazinane.
| Compound Name | 1,3,5-tris(1-thiophen-2-ylethyl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 68714918 |
| Molecular Formula | C21H27N3S3 |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 1,3,5-tris(1-thiophen-2-ylethyl)-1,3,5-triazinane |
| SMILES | CC(c1cccs1)N1CN(C(C)c2cccs2)CN(C(C)c2cccs2)C1 |
| InChI | InChI=1S/C21H27N3S3/c1-16(19-7-4-10-25-19)22-13-23(17(2)20-8-5-11-26-20)15-24(14-22)18(3)21-9-6-12-27-21/h4-12,16-18H,13-15H2,1-3H3 |
| InChIKey | VJXDUHIQKHVDIA-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |