C14H18Cl2N2S — CID 159365099
2,4-dichloro-6-propan-2-ylpyrimidine;2-propan-2-ylthiophene (PubChem CID 159365099) has the molecular formula C14H18Cl2N2S and a molecular weight of 317.29 g/mol. Its IUPAC name is 2,4-dichloro-6-propan-2-ylpyrimidine;2-propan-2-ylthiophene.
| Compound Name | 2,4-dichloro-6-propan-2-ylpyrimidine;2-propan-2-ylthiophene |
|---|---|
| PubChem CID | 159365099 |
| Molecular Formula | C14H18Cl2N2S |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2,4-dichloro-6-propan-2-ylpyrimidine;2-propan-2-ylthiophene |
| SMILES | CC(C)c1cc(Cl)nc(Cl)n1.CC(C)c1cccs1 |
| InChI | InChI=1S/C7H8Cl2N2.C7H10S/c1-4(2)5-3-6(8)11-7(9)10-5;1-6(2)7-4-3-5-8-7/h3-4H,1-2H3;3-6H,1-2H3 |
| InChIKey | LJAIPBPFMHSQPF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |