C13H16ClN3S — CID 114070560
6-chloro-2-N-(2-methyl-1-thiophen-2-ylpropyl)pyridine-2,4-diamine (PubChem CID 114070560) has the molecular formula C13H16ClN3S and a molecular weight of 281.81 g/mol. Its IUPAC name is 6-chloro-2-N-(2-methyl-1-thiophen-2-ylpropyl)pyridine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(2-methyl-1-thiophen-2-ylpropyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 114070560 |
| Molecular Formula | C13H16ClN3S |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 6-chloro-2-N-(2-methyl-1-thiophen-2-ylpropyl)pyridine-2,4-diamine |
| SMILES | CC(C)C(Nc1cc(N)cc(Cl)n1)c1cccs1 |
| InChI | InChI=1S/C13H16ClN3S/c1-8(2)13(10-4-3-5-18-10)17-12-7-9(15)6-11(14)16-12/h3-8,13H,1-2H3,(H3,15,16,17) |
| InChIKey | PVSVEZKZFSXNBY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|