C14H21N5S — CID 80904535
6-hydrazinyl-2,5-dimethyl-N-(2-methyl-1-thiophen-2-ylpropyl)pyrimidin-4-amine (PubChem CID 80904535) has the molecular formula C14H21N5S and a molecular weight of 291.42 g/mol. Its IUPAC name is 6-hydrazinyl-2,5-dimethyl-N-(2-methyl-1-thiophen-2-ylpropyl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-2,5-dimethyl-N-(2-methyl-1-thiophen-2-ylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80904535 |
| Molecular Formula | C14H21N5S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 6-hydrazinyl-2,5-dimethyl-N-(2-methyl-1-thiophen-2-ylpropyl)pyrimidin-4-amine |
| SMILES | Cc1nc(NN)c(C)c(NC(c2cccs2)C(C)C)n1 |
| InChI | InChI=1S/C14H21N5S/c1-8(2)12(11-6-5-7-20-11)18-13-9(3)14(19-15)17-10(4)16-13/h5-8,12H,15H2,1-4H3,(H2,16,17,18,19) |
| InChIKey | SAUJFEPRQWNZFO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|