C14H16N4S — CID 103467928
5-amino-6-[(2-methyl-1-thiophen-2-ylpropyl)amino]pyridine-3-carbonitrile (PubChem CID 103467928) has the molecular formula C14H16N4S and a molecular weight of 272.38 g/mol. Its IUPAC name is 5-amino-6-[(2-methyl-1-thiophen-2-ylpropyl)amino]pyridine-3-carbonitrile.
| Compound Name | 5-amino-6-[(2-methyl-1-thiophen-2-ylpropyl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103467928 |
| Molecular Formula | C14H16N4S |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 5-amino-6-[(2-methyl-1-thiophen-2-ylpropyl)amino]pyridine-3-carbonitrile |
| SMILES | CC(C)C(Nc1ncc(C#N)cc1N)c1cccs1 |
| InChI | InChI=1S/C14H16N4S/c1-9(2)13(12-4-3-5-19-12)18-14-11(16)6-10(7-15)8-17-14/h3-6,8-9,13H,16H2,1-2H3,(H,17,18) |
| InChIKey | QWRQOKDTIWEEQO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |