C14H15F2NS — CID 43765004
3,5-difluoro-N-(2-methyl-1-thiophen-2-ylpropyl)aniline (PubChem CID 43765004) has the molecular formula C14H15F2NS and a molecular weight of 267.34 g/mol. Its IUPAC name is 3,5-difluoro-N-(2-methyl-1-thiophen-2-ylpropyl)aniline.
| Compound Name | 3,5-difluoro-N-(2-methyl-1-thiophen-2-ylpropyl)aniline |
|---|---|
| PubChem CID | 43765004 |
| Molecular Formula | C14H15F2NS |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 3,5-difluoro-N-(2-methyl-1-thiophen-2-ylpropyl)aniline |
| SMILES | CC(C)C(Nc1cc(F)cc(F)c1)c1cccs1 |
| InChI | InChI=1S/C14H15F2NS/c1-9(2)14(13-4-3-5-18-13)17-12-7-10(15)6-11(16)8-12/h3-9,14,17H,1-2H3 |
| InChIKey | CECXDMFKGCIHES-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |