C18H22N2O2S — CID 3833825
1-[1,3-benzodioxol-5-yl-(4-methylthiophen-2-yl)methyl]-1,4-diazepane (PubChem CID 3833825) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is 1-[1,3-benzodioxol-5-yl-(4-methylthiophen-2-yl)methyl]-1,4-diazepane.
| Compound Name | 1-[1,3-benzodioxol-5-yl-(4-methylthiophen-2-yl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3833825 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-[1,3-benzodioxol-5-yl-(4-methylthiophen-2-yl)methyl]-1,4-diazepane |
| SMILES | Cc1csc(C(c2ccc3c(c2)OCO3)N2CCCNCC2)c1 |
| InChI | InChI=1S/C18H22N2O2S/c1-13-9-17(23-11-13)18(20-7-2-5-19-6-8-20)14-3-4-15-16(10-14)22-12-21-15/h3-4,9-11,18-19H,2,5-8,12H2,1H3 |
| InChIKey | FYQFCQMGZJWSOM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |