C16H20ClFN2O2 — CID 171175471
1-[(S)-(3-fluoro-2-methoxyphenyl)-(furan-2-yl)methyl]piperazine;hydrochloride (PubChem CID 171175471) has the molecular formula C16H20ClFN2O2 and a molecular weight of 326.80 g/mol. Its IUPAC name is 1-[(S)-(3-fluoro-2-methoxyphenyl)-(furan-2-yl)methyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-(3-fluoro-2-methoxyphenyl)-(furan-2-yl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171175471 |
| Molecular Formula | C16H20ClFN2O2 |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-[(S)-(3-fluoro-2-methoxyphenyl)-(furan-2-yl)methyl]piperazine;hydrochloride |
| SMILES | COc1c(F)cccc1[C@@H](c1ccco1)N1CCNCC1.Cl |
| InChI | InChI=1S/C16H19FN2O2.ClH/c1-20-16-12(4-2-5-13(16)17)15(14-6-3-11-21-14)19-9-7-18-8-10-19;/h2-6,11,15,18H,7-10H2,1H3;1H/t15-;/m0./s1 |
| InChIKey | KDQMSFALWONKKP-RSAXXLAASA-N |
| XLogP | 2.84 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |