C16H18F2N2O2 — CID 171181410
1-[(R)-(2,6-difluoro-4-methoxyphenyl)-(furan-2-yl)methyl]piperazine (PubChem CID 171181410) has the molecular formula C16H18F2N2O2 and a molecular weight of 308.33 g/mol. Its IUPAC name is 1-[(R)-(2,6-difluoro-4-methoxyphenyl)-(furan-2-yl)methyl]piperazine.
| Compound Name | 1-[(R)-(2,6-difluoro-4-methoxyphenyl)-(furan-2-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171181410 |
| Molecular Formula | C16H18F2N2O2 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-[(R)-(2,6-difluoro-4-methoxyphenyl)-(furan-2-yl)methyl]piperazine |
| SMILES | COc1cc(F)c([C@H](c2ccco2)N2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C16H18F2N2O2/c1-21-11-9-12(17)15(13(18)10-11)16(14-3-2-8-22-14)20-6-4-19-5-7-20/h2-3,8-10,16,19H,4-7H2,1H3/t16-/m0/s1 |
| InChIKey | WEFBDVQMXFAMLT-INIZCTEOSA-N |
| XLogP | 2.56 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |