C23H34Cl2N2O3 — CID 171295603
1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)butyl]piperazine;dihydrochloride (PubChem CID 171295603) has the molecular formula C23H34Cl2N2O3 and a molecular weight of 457.44 g/mol. Its IUPAC name is 1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171295603 |
| Molecular Formula | C23H34Cl2N2O3 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)butyl]piperazine;dihydrochloride |
| SMILES | CCC[C@H](c1cc(OC)c(OC)cc1OCc1ccccc1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C23H32N2O3.2ClH/c1-4-8-20(25-13-11-24-12-14-25)19-15-22(26-2)23(27-3)16-21(19)28-17-18-9-6-5-7-10-18;;/h5-7,9-10,15-16,20,24H,4,8,11-14,17H2,1-3H3;2*1H/t20-;;/m1../s1 |
| InChIKey | IPADAFSRLAEKDB-FAVHNTAZSA-N |
| XLogP | 4.87 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |