C22H28N2O3 — CID 171282960
1-[(1S)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)prop-2-enyl]piperazine (PubChem CID 171282960) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-[(1S)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)prop-2-enyl]piperazine.
| Compound Name | 1-[(1S)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)prop-2-enyl]piperazine |
|---|---|
| PubChem CID | 171282960 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1-[(1S)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)prop-2-enyl]piperazine |
| SMILES | C=C[C@@H](c1cc(OC)c(OC)cc1OCc1ccccc1)N1CCNCC1 |
| InChI | InChI=1S/C22H28N2O3/c1-4-19(24-12-10-23-11-13-24)18-14-21(25-2)22(26-3)15-20(18)27-16-17-8-6-5-7-9-17/h4-9,14-15,19,23H,1,10-13,16H2,2-3H3/t19-/m0/s1 |
| InChIKey | KZRLVDWJPGWCLG-IBGZPJMESA-N |
| XLogP | 3.42 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|