C24H32N2O3 — CID 171295610
1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)pent-4-enyl]piperazine (PubChem CID 171295610) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is 1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)pent-4-enyl]piperazine.
| Compound Name | 1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)pent-4-enyl]piperazine |
|---|---|
| PubChem CID | 171295610 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)pent-4-enyl]piperazine |
| SMILES | C=CCC[C@H](c1cc(OC)c(OC)cc1OCc1ccccc1)N1CCNCC1 |
| InChI | InChI=1S/C24H32N2O3/c1-4-5-11-21(26-14-12-25-13-15-26)20-16-23(27-2)24(28-3)17-22(20)29-18-19-9-7-6-8-10-19/h4,6-10,16-17,21,25H,1,5,11-15,18H2,2-3H3/t21-/m1/s1 |
| InChIKey | IBGVGBVSXFFFCR-OAQYLSRUSA-N |
| XLogP | 4.20 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|