C22H29FN2O3 — CID 171172771
1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-3-fluoropropyl]piperazine (PubChem CID 171172771) has the molecular formula C22H29FN2O3 and a molecular weight of 388.48 g/mol. Its IUPAC name is 1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-3-fluoropropyl]piperazine.
| Compound Name | 1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-3-fluoropropyl]piperazine |
|---|---|
| PubChem CID | 171172771 |
| Molecular Formula | C22H29FN2O3 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-3-fluoropropyl]piperazine |
| SMILES | COc1cc(OCc2ccccc2)c([C@@H](CCF)N2CCNCC2)cc1OC |
| InChI | InChI=1S/C22H29FN2O3/c1-26-21-14-18(19(8-9-23)25-12-10-24-11-13-25)20(15-22(21)27-2)28-16-17-6-4-3-5-7-17/h3-7,14-15,19,24H,8-13,16H2,1-2H3/t19-/m1/s1 |
| InChIKey | ZFAFBFQIXYOFRI-LJQANCHMSA-N |
| XLogP | 3.59 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |