C22H32Cl2N2O3 — CID 171295579
1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)propyl]piperazine;dihydrochloride (PubChem CID 171295579) has the molecular formula C22H32Cl2N2O3 and a molecular weight of 443.42 g/mol. Its IUPAC name is 1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)propyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)propyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171295579 |
| Molecular Formula | C22H32Cl2N2O3 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)propyl]piperazine;dihydrochloride |
| SMILES | CC[C@H](c1cc(OC)c(OC)cc1OCc1ccccc1)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C22H30N2O3.2ClH/c1-4-19(24-12-10-23-11-13-24)18-14-21(25-2)22(26-3)15-20(18)27-16-17-8-6-5-7-9-17;;/h5-9,14-15,19,23H,4,10-13,16H2,1-3H3;2*1H/t19-;;/m1../s1 |
| InChIKey | RTEHLAJDXAREPA-JQDLGSOUSA-N |
| XLogP | 4.48 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |