C16H26N2O2 — CID 171296646
2-ethoxy-6-[(1R)-1-piperazin-1-ylbutyl]phenol (PubChem CID 171296646) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-ethoxy-6-[(1R)-1-piperazin-1-ylbutyl]phenol.
| Compound Name | 2-ethoxy-6-[(1R)-1-piperazin-1-ylbutyl]phenol |
|---|---|
| PubChem CID | 171296646 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-ethoxy-6-[(1R)-1-piperazin-1-ylbutyl]phenol |
| SMILES | CCC[C@H](c1cccc(OCC)c1O)N1CCNCC1 |
| InChI | InChI=1S/C16H26N2O2/c1-3-6-14(18-11-9-17-10-12-18)13-7-5-8-15(16(13)19)20-4-2/h5,7-8,14,17,19H,3-4,6,9-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | DJLFHWLRRIFUQQ-CQSZACIVSA-N |
| XLogP | 2.54 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|