C16H26Cl2N2O2 — CID 171284011
2-ethoxy-6-[(1S)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride (PubChem CID 171284011) has the molecular formula C16H26Cl2N2O2 and a molecular weight of 349.30 g/mol. Its IUPAC name is 2-ethoxy-6-[(1S)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride.
| Compound Name | 2-ethoxy-6-[(1S)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171284011 |
| Molecular Formula | C16H26Cl2N2O2 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-ethoxy-6-[(1S)-1-piperazin-1-ylbut-3-enyl]phenol;dihydrochloride |
| SMILES | C=CC[C@@H](c1cccc(OCC)c1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H24N2O2.2ClH/c1-3-6-14(18-11-9-17-10-12-18)13-7-5-8-15(16(13)19)20-4-2;;/h3,5,7-8,14,17,19H,1,4,6,9-12H2,2H3;2*1H/t14-;;/m0../s1 |
| InChIKey | UPBCSYNMWMLGCW-UTLKBRERSA-N |
| XLogP | 3.16 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|