C17H26F2N2O — CID 171311153
1-[(1R)-1-[2-(difluoromethoxy)phenyl]-4-methylpentyl]piperazine (PubChem CID 171311153) has the molecular formula C17H26F2N2O and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-[(1R)-1-[2-(difluoromethoxy)phenyl]-4-methylpentyl]piperazine.
| Compound Name | 1-[(1R)-1-[2-(difluoromethoxy)phenyl]-4-methylpentyl]piperazine |
|---|---|
| PubChem CID | 171311153 |
| Molecular Formula | C17H26F2N2O |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-[(1R)-1-[2-(difluoromethoxy)phenyl]-4-methylpentyl]piperazine |
| SMILES | CC(C)CC[C@H](c1ccccc1OC(F)F)N1CCNCC1 |
| InChI | InChI=1S/C17H26F2N2O/c1-13(2)7-8-15(21-11-9-20-10-12-21)14-5-3-4-6-16(14)22-17(18)19/h3-6,13,15,17,20H,7-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | FMAAHZYLMSHUMJ-OAHLLOKOSA-N |
| XLogP | 3.67 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |