C16H20ClF3N2 — CID 171292685
1-[(1R)-1-[2-chloro-3-(trifluoromethyl)phenyl]pent-4-enyl]piperazine (PubChem CID 171292685) has the molecular formula C16H20ClF3N2 and a molecular weight of 332.80 g/mol. Its IUPAC name is 1-[(1R)-1-[2-chloro-3-(trifluoromethyl)phenyl]pent-4-enyl]piperazine.
| Compound Name | 1-[(1R)-1-[2-chloro-3-(trifluoromethyl)phenyl]pent-4-enyl]piperazine |
|---|---|
| PubChem CID | 171292685 |
| Molecular Formula | C16H20ClF3N2 |
| Molecular Weight | 332.80 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-[(1R)-1-[2-chloro-3-(trifluoromethyl)phenyl]pent-4-enyl]piperazine |
| SMILES | C=CCC[C@H](c1cccc(C(F)(F)F)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C16H20ClF3N2/c1-2-3-7-14(22-10-8-21-9-11-22)12-5-4-6-13(15(12)17)16(18,19)20/h2,4-6,14,21H,1,3,7-11H2/t14-/m1/s1 |
| InChIKey | ULFUQIKUZIOQBG-CQSZACIVSA-N |
| XLogP | 4.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.80 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|