C15H21Cl2F3N2 — CID 171166305
1-[(1S)-1-[2-chloro-3-(trifluoromethyl)phenyl]butyl]piperazine;hydrochloride (PubChem CID 171166305) has the molecular formula C15H21Cl2F3N2 and a molecular weight of 357.25 g/mol. Its IUPAC name is 1-[(1S)-1-[2-chloro-3-(trifluoromethyl)phenyl]butyl]piperazine;hydrochloride.
| Compound Name | 1-[(1S)-1-[2-chloro-3-(trifluoromethyl)phenyl]butyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171166305 |
| Molecular Formula | C15H21Cl2F3N2 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 1-[(1S)-1-[2-chloro-3-(trifluoromethyl)phenyl]butyl]piperazine;hydrochloride |
| SMILES | CCC[C@@H](c1cccc(C(F)(F)F)c1Cl)N1CCNCC1.Cl |
| InChI | InChI=1S/C15H20ClF3N2.ClH/c1-2-4-13(21-9-7-20-8-10-21)11-5-3-6-12(14(11)16)15(17,18)19;/h3,5-6,13,20H,2,4,7-10H2,1H3;1H/t13-;/m0./s1 |
| InChIKey | JDHAUMROLAKLPA-ZOWNYOTGSA-N |
| XLogP | 4.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |