C14H18ClF5N2 — CID 171170871
1-[(1R)-3-fluoro-1-[2-fluoro-3-(trifluoromethyl)phenyl]propyl]piperazine;hydrochloride (PubChem CID 171170871) has the molecular formula C14H18ClF5N2 and a molecular weight of 344.76 g/mol. Its IUPAC name is 1-[(1R)-3-fluoro-1-[2-fluoro-3-(trifluoromethyl)phenyl]propyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-3-fluoro-1-[2-fluoro-3-(trifluoromethyl)phenyl]propyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171170871 |
| Molecular Formula | C14H18ClF5N2 |
| Molecular Weight | 344.76 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-[(1R)-3-fluoro-1-[2-fluoro-3-(trifluoromethyl)phenyl]propyl]piperazine;hydrochloride |
| SMILES | Cl.FCC[C@H](c1cccc(C(F)(F)F)c1F)N1CCNCC1 |
| InChI | InChI=1S/C14H17F5N2.ClH/c15-5-4-12(21-8-6-20-7-9-21)10-2-1-3-11(13(10)16)14(17,18)19;/h1-3,12,20H,4-9H2;1H/t12-;/m1./s1 |
| InChIKey | ZXZMICTXSFODKL-UTONKHPSSA-N |
| XLogP | 3.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.76 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |