C16H22F2N2O — CID 171180855
1-[(S)-cyclobutyl-[2-(difluoromethoxy)phenyl]methyl]piperazine (PubChem CID 171180855) has the molecular formula C16H22F2N2O and a molecular weight of 296.36 g/mol. Its IUPAC name is 1-[(S)-cyclobutyl-[2-(difluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[(S)-cyclobutyl-[2-(difluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171180855 |
| Molecular Formula | C16H22F2N2O |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1-[(S)-cyclobutyl-[2-(difluoromethoxy)phenyl]methyl]piperazine |
| SMILES | FC(F)Oc1ccccc1[C@H](C1CCC1)N1CCNCC1 |
| InChI | InChI=1S/C16H22F2N2O/c17-16(18)21-14-7-2-1-6-13(14)15(12-4-3-5-12)20-10-8-19-9-11-20/h1-2,6-7,12,15-16,19H,3-5,8-11H2/t15-/m0/s1 |
| InChIKey | KMHDZUZOGSFIAT-HNNXBMFYSA-N |
| XLogP | 3.03 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |