C11H16ClNO3 — CID 171889814
1-(3-chloro-4-hydroxyphenyl)-4-(methylamino)butane-1,2-diol (PubChem CID 171889814) has the molecular formula C11H16ClNO3 and a molecular weight of 245.71 g/mol. Its IUPAC name is 1-(3-chloro-4-hydroxyphenyl)-4-(methylamino)butane-1,2-diol.
| Compound Name | 1-(3-chloro-4-hydroxyphenyl)-4-(methylamino)butane-1,2-diol |
|---|---|
| PubChem CID | 171889814 |
| Molecular Formula | C11H16ClNO3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1-(3-chloro-4-hydroxyphenyl)-4-(methylamino)butane-1,2-diol |
| SMILES | CNCCC(O)C(O)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C11H16ClNO3/c1-13-5-4-10(15)11(16)7-2-3-9(14)8(12)6-7/h2-3,6,10-11,13-16H,4-5H2,1H3 |
| InChIKey | DNOBAISWSVBTDJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |