C12H18OS — CID 63900161
1-(3,5-dimethylphenyl)-3-methylsulfanylpropan-1-ol (PubChem CID 63900161) has the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-methylsulfanylpropan-1-ol.
| Compound Name | 1-(3,5-dimethylphenyl)-3-methylsulfanylpropan-1-ol |
|---|---|
| PubChem CID | 63900161 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-methylsulfanylpropan-1-ol |
| SMILES | CSCCC(O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C12H18OS/c1-9-6-10(2)8-11(7-9)12(13)4-5-14-3/h6-8,12-13H,4-5H2,1-3H3 |
| InChIKey | GINYGEKFEOTLRK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |