About (4S)-4-(3,5-dimethylphenyl)-4-hydroxybutanamide
(4S)-4-(3,5-dimethylphenyl)-4-hydroxybutanamide (PubChem CID 68997524) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is (4S)-4-(3,5-dimethylphenyl)-4-hydroxybutanamide.
Molecular Properties
| Compound Name | (4S)-4-(3,5-dimethylphenyl)-4-hydroxybutanamide |
| PubChem CID | 68997524 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (4S)-4-(3,5-dimethylphenyl)-4-hydroxybutanamide |
| SMILES | Cc1cc(C)cc([C@@H](O)CCC(N)=O)c1 |
| InChI | InChI=1S/C12H17NO2/c1-8-5-9(2)7-10(6-8)11(14)3-4-12(13)15/h5-7,11,14H,3-4H2,1-2H3,(H2,13,15)/t11-/m0/s1 |
| InChIKey | JAKFLHHPOSQARH-NSHDSACASA-N |
| XLogP | 1.60 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-4-(3,5-dimethylphenyl)-4-hydroxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(3,5-dimethylphenyl)-4-hydroxybutanamide?
The IUPAC name of (4S)-4-(3,5-dimethylphenyl)-4-hydroxybutanamide (CID 68997524) is (4S)-4-(3,5-dimethylphenyl)-4-hydroxybutanamide.
What is the SMILES notation for (4S)-4-(3,5-dimethylphenyl)-4-hydroxybutanamide?
The canonical SMILES for (4S)-4-(3,5-dimethylphenyl)-4-hydroxybutanamide is Cc1cc(C)cc([C@@H](O)CCC(N)=O)c1.
What is the InChIKey of (4S)-4-(3,5-dimethylphenyl)-4-hydroxybutanamide?
The InChIKey is JAKFLHHPOSQARH-NSHDSACASA-N. The full InChI is InChI=1S/C12H17NO2/c1-8-5-9(2)7-10(6-8)11(14)3-4-12(13)15/h5-7,11,14H,3-4H2,1-2H3,(H2,13,15)/t11-/m0/s1.
What are the key properties of (4S)-4-(3,5-dimethylphenyl)-4-hydroxybutanamide?
(4S)-4-(3,5-dimethylphenyl)-4-hydroxybutanamide has a molecular weight of 207.27 g/mol, XLogP of 1.60, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(3,5-dimethylphenyl)-4-hydroxybutanamide is sourced from PubChem (CID 68997524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).