C7H14F2O2 — CID 103147788
1-(2,2-difluoroethoxy)pentan-3-ol (PubChem CID 103147788) has the molecular formula C7H14F2O2 and a molecular weight of 168.18 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)pentan-3-ol.
| Compound Name | 1-(2,2-difluoroethoxy)pentan-3-ol |
|---|---|
| PubChem CID | 103147788 |
| Molecular Formula | C7H14F2O2 |
| Molecular Weight | 168.18 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 1-(2,2-difluoroethoxy)pentan-3-ol |
| SMILES | CCC(O)CCOCC(F)F |
| InChI | InChI=1S/C7H14F2O2/c1-2-6(10)3-4-11-5-7(8)9/h6-7,10H,2-5H2,1H3 |
| InChIKey | BFUTYYOLROWZFP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.18 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|