C6H13F2NO — CID 103151198
(2R)-4-(2,2-difluoroethoxy)butan-2-amine (PubChem CID 103151198) has the molecular formula C6H13F2NO and a molecular weight of 153.17 g/mol. Its IUPAC name is (2R)-4-(2,2-difluoroethoxy)butan-2-amine.
| Compound Name | (2R)-4-(2,2-difluoroethoxy)butan-2-amine |
|---|---|
| PubChem CID | 103151198 |
| Molecular Formula | C6H13F2NO |
| Molecular Weight | 153.17 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | (2R)-4-(2,2-difluoroethoxy)butan-2-amine |
| SMILES | C[C@@H](N)CCOCC(F)F |
| InChI | InChI=1S/C6H13F2NO/c1-5(9)2-3-10-4-6(7)8/h5-6H,2-4,9H2,1H3/t5-/m1/s1 |
| InChIKey | DRGUBSXIWYJUSZ-RXMQYKEDSA-N |
| XLogP | 1.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.17 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|