C11H18FN3S — CID 105226545
[2-tert-butylsulfanyl-1-(5-fluoro-3-pyridinyl)ethyl]hydrazine (PubChem CID 105226545) has the molecular formula C11H18FN3S and a molecular weight of 243.35 g/mol. Its IUPAC name is [2-tert-butylsulfanyl-1-(5-fluoro-3-pyridinyl)ethyl]hydrazine.
| Compound Name | [2-tert-butylsulfanyl-1-(5-fluoro-3-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105226545 |
| Molecular Formula | C11H18FN3S |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | [2-tert-butylsulfanyl-1-(5-fluoro-3-pyridinyl)ethyl]hydrazine |
| SMILES | CC(C)(C)SCC(NN)c1cncc(F)c1 |
| InChI | InChI=1S/C11H18FN3S/c1-11(2,3)16-7-10(15-13)8-4-9(12)6-14-5-8/h4-6,10,15H,7,13H2,1-3H3 |
| InChIKey | KDJYADZEGITCKV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|