C14H25N3 — CID 105244054
N,N-diethyl-3-hydrazinyl-3-(3-methylphenyl)propan-1-amine (PubChem CID 105244054) has the molecular formula C14H25N3 and a molecular weight of 235.38 g/mol. Its IUPAC name is N,N-diethyl-3-hydrazinyl-3-(3-methylphenyl)propan-1-amine.
| Compound Name | N,N-diethyl-3-hydrazinyl-3-(3-methylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 105244054 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N,N-diethyl-3-hydrazinyl-3-(3-methylphenyl)propan-1-amine |
| SMILES | CCN(CC)CCC(NN)c1cccc(C)c1 |
| InChI | InChI=1S/C14H25N3/c1-4-17(5-2)10-9-14(16-15)13-8-6-7-12(3)11-13/h6-8,11,14,16H,4-5,9-10,15H2,1-3H3 |
| InChIKey | XYXHPOLJEFWYFU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|