C11H21N3O — CID 105243941
N,N-diethyl-3-(furan-2-yl)-3-hydrazinylpropan-1-amine (PubChem CID 105243941) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is N,N-diethyl-3-(furan-2-yl)-3-hydrazinylpropan-1-amine.
| Compound Name | N,N-diethyl-3-(furan-2-yl)-3-hydrazinylpropan-1-amine |
|---|---|
| PubChem CID | 105243941 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | N,N-diethyl-3-(furan-2-yl)-3-hydrazinylpropan-1-amine |
| SMILES | CCN(CC)CCC(NN)c1ccco1 |
| InChI | InChI=1S/C11H21N3O/c1-3-14(4-2)8-7-10(13-12)11-6-5-9-15-11/h5-6,9-10,13H,3-4,7-8,12H2,1-2H3 |
| InChIKey | QUOMPPXFTKWLKL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 54.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|