C8H14N2OS — CID 105306045
[1-(furan-2-yl)-3-methylsulfanylpropyl]hydrazine (PubChem CID 105306045) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is [1-(furan-2-yl)-3-methylsulfanylpropyl]hydrazine.
| Compound Name | [1-(furan-2-yl)-3-methylsulfanylpropyl]hydrazine |
|---|---|
| PubChem CID | 105306045 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | [1-(furan-2-yl)-3-methylsulfanylpropyl]hydrazine |
| SMILES | CSCCC(NN)c1ccco1 |
| InChI | InChI=1S/C8H14N2OS/c1-12-6-4-7(10-9)8-3-2-5-11-8/h2-3,5,7,10H,4,6,9H2,1H3 |
| InChIKey | KSAWRLFBOJHATL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|